| Product Name | 2-Chloro-5-methylphenol |
| CAS No. | 615-74-7 |
| Synonyms | 4-Chloro-3-hydroxytoluene; 6-chloro-m-cresol |
| InChI | InChI=1/C7H7ClO/c1-5-2-3-6(8)7(9)4-5/h2-4,9H,1H3 |
| Molecular Formula | C7H7ClO |
| Molecular Weight | 142.58 |
| Density | 1.215 |
| Melting point | 45-48℃ |
| Boiling point | 196℃ |
| Flash point | 81℃ |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
615-74-7 2-chloro-5-methylphenol
service@apichina.com