| Product Name | 2-Chloro-5-methoxybenzimidazole |
| CAS No. | 15965-54-5 |
| Synonyms | 2-chloro-6-methoxy-1H-benzimidazole |
| InChI | InChI=1/C8H7ClN2O/c1-12-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3,(H,10,11) |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.607 |
| Density | 1.393g/cm3 |
| Boiling point | 365.7°C at 760 mmHg |
| Flash point | 175°C |
| Refractive index | 1.656 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
15965-54-5 2-chloro-5-methoxybenzimidazole
service@apichina.com