| Product Name | 2-chloro-4-nitrophenyl isothiocyanate |
| CAS No. | 23165-64-2 |
| Synonyms | 2-chloro-1-isothiocyanato-4-nitrobenzene |
| InChI | InChI=1/C7H3ClN2O2S/c8-6-3-5(10(11)12)1-2-7(6)9-4-13/h1-3H |
| Molecular Formula | C7H3ClN2O2S |
| Molecular Weight | 214.6289 |
| Density | 1.48g/cm3 |
| Melting point | 95-99℃ |
| Boiling point | 354.1°C at 760 mmHg |
| Flash point | 167.9°C |
| Refractive index | 1.651 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
23165-64-2 2-chloro-4-nitrophenyl isothiocyanate
service@apichina.com