| Product Name | 2-chloro-4-methylphenyl isothiocyanate |
| CAS No. | 57878-93-0 |
| Synonyms | 2-Chloro-4-methylphenyl isothiocyanate; 2-chloro-1-isothiocyanato-4-methylbenzene |
| InChI | InChI=1/C8H6ClNS/c1-6-2-3-8(10-5-11)7(9)4-6/h2-4H,1H3 |
| Molecular Formula | C8H6ClNS |
| Molecular Weight | 183.6579 |
| Density | 1.18g/cm3 |
| Boiling point | 286.8°C at 760 mmHg |
| Flash point | 127.3°C |
| Refractive index | 1.583 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
57878-93-0 2-chloro-4-methylphenyl isothiocyanate
service@apichina.com