| Product Name | 2-chloro-4-fluoroacetophenone |
| CAS No. | 700-35-6 |
| Synonyms | 2'-chloro-4'-fluoroacetophenone; 1-(2-chloro-4-fluoro-phenyl)ethanone |
| InChI | InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.584 |
| Density | 1.259g/cm3 |
| Boiling point | 203.4°C at 760 mmHg |
| Flash point | 76.814°C |
| Refractive index | 1.512 |
| Risk Codes | R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
700-35-6 2-chloro-4-fluoroacetophenone
service@apichina.com