| Product Name | 2-chloro-4-(dimethylamino)benzaldehyde |
| CAS No. | 1424-66-4 |
| Synonyms | Benzaldehyde, 2-chloro-4-(dimethylamino)-; 2-Chloro-4-(dimethylamino)benzaldehyde; NSC 93918; 2-Chloro-4-dimethylaminobenzaldehyde |
| InChI | InChI=1/C9H10ClNO/c1-11(2)8-4-3-7(6-12)9(10)5-8/h3-6H,1-2H3 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.6348 |
| Density | 1.215g/cm3 |
| Melting point | 70℃ |
| Boiling point | 309.4°C at 760 mmHg |
| Flash point | 140.9°C |
| Refractive index | 1.607 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1424-66-4 2-chloro-4-(dimethylamino)benzaldehyde
service@apichina.com