| Product Name | 2-chloro-4,5-dimethylphenol |
| CAS No. | 1124-04-5 |
| Synonyms | 6-Chloro-3,4-xylenol (OH=1); 6-Chloro-3,4-xylenol |
| InChI | InChI=1/C8H9ClO/c1-5-3-7(9)8(10)4-6(5)2/h3-4,10H,1-2H3 |
| Molecular Formula | C8H9ClO |
| Molecular Weight | 156.6095 |
| Density | 1.183g/cm3 |
| Melting point | 70-72℃ |
| Boiling point | 237°C at 760 mmHg |
| Flash point | 97.1°C |
| Refractive index | 1.558 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1124-04-5 2-chloro-4,5-dimethylphenol
service@apichina.com