| Product Name | 2-Chloro-4,5-dimethoxybenzaldehyde |
| CAS No. | 18093-05-5 |
| InChI | InChI=1/C9H9ClO3/c1-12-8-3-6(5-11)7(10)4-9(8)13-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.619 |
| Density | 1.245g/cm3 |
| Boiling point | 303.6°C at 760 mmHg |
| Flash point | 132.3°C |
| Refractive index | 1.549 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
18093-05-5 2-chloro-4,5-dimethoxybenzaldehyde
service@apichina.com