| Product Name | 2-chloro-3-morpholino-1,4-naphthoquinone |
| CAS No. | 6336-72-7 |
| Synonyms | 2-Chloro-3-(4-morpholino)-1,4-naphthoquinone; 2-chloro-3-(morpholin-4-yl)naphthalene-1,4-dione |
| InChI | InChI=1/C14H12ClNO3/c15-11-12(16-5-7-19-8-6-16)14(18)10-4-2-1-3-9(10)13(11)17/h1-4H,5-8H2 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.703 |
| Density | 1.42g/cm3 |
| Melting point | 155-157℃ |
| Boiling point | 398.7°C at 760 mmHg |
| Flash point | 194.9°C |
| Refractive index | 1.636 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6336-72-7 2-chloro-3-morpholino-1,4-naphthoquinone
service@apichina.com