| Product Name | 2-Chloro-3-fluoro-4-nitropyridine N-oxide |
| CAS No. | 101664-56-6 |
| Synonyms | 2-chloro-3-fluoro-4-nitro-pyridine 1-oxide |
| InChI | InChI=1/C5H2ClFN2O3/c6-5-4(7)3(9(11)12)1-2-8(5)10/h1-2H |
| Molecular Formula | C5H2ClFN2O3 |
| Molecular Weight | 192.5324 |
| Density | 1.748g/cm3 |
| Boiling point | 428.758°C at 760 mmHg |
| Flash point | 213.106°C |
| Refractive index | 1.606 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
101664-56-6 2-chloro-3-fluoro-4-nitropyridine n-oxide
service@apichina.com