| Product Name | 2-Chloro-3,6-difluorobenzylamine |
| CAS No. | 261762-45-2 |
| Synonyms | 1-(2-chloro-3,6-difluorophenyl)methanamine |
| InChI | InChI=1/C7H6ClF2N/c8-7-4(3-11)5(9)1-2-6(7)10/h1-2H,3,11H2 |
| Molecular Formula | C7H6ClF2N |
| Molecular Weight | 177.579 |
| Density | 1.368g/cm3 |
| Boiling point | 210.3°C at 760 mmHg |
| Flash point | 81°C |
| Refractive index | 1.522 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
261762-45-2 2-chloro-3,6-difluorobenzylamine
service@apichina.com