| Product Name | 2-Chloro-3,6-difluorobenzyl bromide |
| CAS No. | 90292-67-4 |
| Synonyms | alpha-Bromo-2-chloro-3,6-difluorotoluene; 2-(bromomethyl)-3-chloro-1,4-difluorobenzene |
| InChI | InChI=1/C7H4BrClF2/c8-3-4-5(10)1-2-6(11)7(4)9/h1-2H,3H2 |
| Molecular Formula | C7H4BrClF2 |
| Molecular Weight | 241.4605 |
| Density | 1.733g/cm3 |
| Boiling point | 221.3°C at 760 mmHg |
| Flash point | 87.6°C |
| Refractive index | 1.541 |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
90292-67-4 2-chloro-3,6-difluorobenzyl bromide
service@apichina.com