| Product Name | 2-Chloro-3,6-difluorobenzoyl chloride |
| CAS No. | 261762-42-9 |
| InChI | InChI=1/C7H2Cl2F2O/c8-6-4(11)2-1-3(10)5(6)7(9)12/h1-2H |
| Molecular Formula | C7H2Cl2F2O |
| Molecular Weight | 210.993 |
| Density | 1.548g/cm3 |
| Boiling point | 218.8°C at 760 mmHg |
| Flash point | 86.1°C |
| Refractive index | 1.519 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
261762-42-9 2-chloro-3,6-difluorobenzoyl chloride
service@apichina.com