| Product Name | 2-Chloro-3,6-difluorobenzaldehyde |
| CAS No. | 261762-39-4 |
| InChI | InChI=1/C7H3ClF2O/c8-7-4(3-11)5(9)1-2-6(7)10/h1-3H |
| Molecular Formula | C7H3ClF2O |
| Molecular Weight | 176.5479 |
| Density | 1.453g/cm3 |
| Melting point | 46-50℃ |
| Boiling point | 206.4°C at 760 mmHg |
| Flash point | 78.6°C |
| Refractive index | 1.536 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
261762-39-4 2-chloro-3,6-difluorobenzaldehyde
service@apichina.com