| Product Name | 2-chloro-1-phenylethanol |
| CAS No. | 1674-30-2 |
| Synonyms | styrene chlorohydrin; [2-(chloromethyl)phenyl]methanol |
| InChI | InChI=1/C8H9ClO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2 |
| Molecular Formula | C8H9ClO |
| Molecular Weight | 156.6095 |
| Density | 1.196g/cm3 |
| Boiling point | 267.289°C at 760 mmHg |
| Flash point | 119.526°C |
| Refractive index | 1.562 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
1674-30-2 2-chloro-1-phenylethanol
service@apichina.com