| Sales Email | Service@apichina.com |
| CAS No. | 156801-47-7 |
| Product Name | 2-chloro-1-(5-chloro-3-methylbenzo[b]thiophen-2-yl)ethan-1-one |
| Synonyms | 2-Chloroacetyl-5-chloro-3-methylbenzo[b]thiophene; 2-chloro-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
| InChI | InChI=1/C11H8Cl2OS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
| Molecular Formula | C11H8Cl2OS |
| Molecular Weight | 259.1516 |
| Density | 1.407g/cm3 |
| Melting point | 158℃ |
| Boiling point | 393.4°C at 760 mmHg |
| Flash point | 191.7°C |
| Refractive index | 1.648 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
