| Product Name | 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one |
| CAS No. | 64218-50-4 |
| Synonyms | 2-chloro-1-(4,5-dichlorothiophen-2-yl)ethanone |
| InChI | InChI=1/C6H3Cl3OS/c7-2-4(10)5-1-3(8)6(9)11-5/h1H,2H2 |
| Molecular Formula | C6H3Cl3OS |
| Molecular Weight | 229.5114 |
| Density | 1.574g/cm3 |
| Melting point | 56℃ |
| Boiling point | 355.8°C at 760 mmHg |
| Flash point | 169°C |
| Refractive index | 1.591 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
64218-50-4 2-chloro-1-(4,5-dichloro-2-thienyl)ethan-1-one
service@apichina.com