| Product Name | (2-Carboxyphenyl)iminodiacetic acid |
| CAS No. | 1147-65-5 |
| Synonyms | N,N-Bis(carboxymethyl)anthranilic acid; 2-[bis(carboxymethyl)amino]benzoic acid |
| InChI | InChI=1/C11H11NO6/c13-9(14)5-12(6-10(15)16)8-4-2-1-3-7(8)11(17)18/h1-4H,5-6H2,(H,13,14)(H,15,16)(H,17,18) |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.2081 |
| Density | 1.56g/cm3 |
| Boiling point | 560.9°C at 760 mmHg |
| Flash point | 293°C |
| Refractive index | 1.66 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1147-65-5 (2-carboxyphenyl)iminodiacetic acid
service@apichina.com