| Product Name | (+/-)-2-butanol |
| CAS No. | 15892-23-6 |
| Synonyms | (±)-2-Butanol; .+/-.-2-Butanol; 15892-23-6; DL-Butan-2-ol; DL-METHYLETHYLCARBINOL; dl-sec-Butanol; methyl-2-propanol; butan-2-ol |
| InChI | InChI=1/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3 |
| Molecular Formula | C4H10O |
| Molecular Weight | 74.1216 |
| Density | 0.801g/cm3 |
| Boiling point | 96.6°C at 760 mmHg |
| Flash point | 26.7°C |
| Refractive index | 1.393 |
| Risk Codes | R10:Flammable.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S13:Keep away from food, drink and animal feeding stuffs.; S24/25:Avoid contact with skin and eyes.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S46:If swallowed, seek medical advice immediately and show this container or label.; S7/9:Keep container tightly closed and in a well-ventilated place.; |
15892-23-6 (+/-)-2-butanol
service@apichina.com