| Product Name | 2-Bromopyridine-4-carboxamide |
| CAS No. | 29840-73-1 |
| Synonyms | 2-Bromoisonicotinamide |
| InChI | InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
| Molecular Formula | C6H5BrN2O |
| Molecular Weight | 201.0207 |
| Density | 1.71g/cm3 |
| Boiling point | 338.1°C at 760 mmHg |
| Flash point | 158.3°C |
| Refractive index | 1.613 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
29840-73-1 2-bromopyridine-4-carboxamide
service@apichina.com