| Product Name | 2-Bromopropene |
| CAS No. | 557-93-7 |
| Synonyms | Bromopropene,90%; 2-Bromo-1-propene; Isopropenyl bromide; 2-bromoprop-1-ene |
| InChI | InChI=1/C3H5Br/c1-3(2)4/h1H2,2H3 |
| Molecular Formula | C3H5Br |
| Molecular Weight | 120.9758 |
| Density | 1.404g/cm3 |
| Boiling point | 48.4°C at 760 mmHg |
| Refractive index | 1.452 |
| Hazard Symbols |  F:Highly flammable;  Xi:Irritant; |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
557-93-7 2-bromopropene
service@apichina.com