| Product Name | 2-Bromophenylthiourea |
| CAS No. | 5391-30-0 |
| Synonyms | Thiourea, (2-bromophenyl)-; 1-(2-bromophenyl)thiourea |
| InChI | InChI=1/C7H7BrN2S/c8-5-3-1-2-4-6(5)10-7(9)11/h1-4H,(H3,9,10,11) |
| Molecular Formula | C7H7BrN2S |
| Molecular Weight | 231.1129 |
| Density | 1.728g/cm3 |
| Boiling point | 314.2°C at 760 mmHg |
| Flash point | 143.8°C |
| Refractive index | 1.748 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5391-30-0 2-bromophenylthiourea
service@apichina.com