| Product Name | 2-Bromooctane |
| CAS No. | 557-35-7 |
| Synonyms | sec-Octyl bromide; 1-Methylheptyl bromide; 2-Bromoooctane; 2-Octyl bromide; NSC 8060; sec-Octyl bromide (VAN); Octane, 2-bromo- |
| InChI | InChI=1/C8H17Br/c1-3-4-5-6-7-8(2)9/h8H,3-7H2,1-2H3 |
| Molecular Formula | C8H17Br |
| Molecular Weight | 193.1246 |
| Density | 1.108g/cm3 |
| Boiling point | 190.8°C at 760 mmHg |
| Flash point | 56.1°C |
| Refractive index | 1.45 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
557-35-7 2-bromooctane
service@apichina.com