| Product Name | 2-(Bromomethyl)acrylic acid |
| CAS No. | 72707-66-5 |
| Synonyms | 2-(bromomethyl)propenoic acid; 2-(bromomethyl)prop-2-enoic acid |
| InChI | InChI=1/C4H5BrO2/c1-3(2-5)4(6)7/h1-2H2,(H,6,7) |
| Molecular Formula | C4H5BrO2 |
| Molecular Weight | 164.9853 |
| Density | 1.696g/cm3 |
| Melting point | 70-73℃ |
| Boiling point | 268.8°C at 760 mmHg |
| Flash point | 116.4°C |
| Refractive index | 1.517 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
72707-66-5 2-(bromomethyl)acrylic acid
service@apichina.com