| Product Name | 2-(Bromomethyl)-1-methyl-1H-benzimidazole |
| CAS No. | 136099-52-0 |
| InChI | InChI=1/C9H9BrN2/c1-12-8-5-3-2-4-7(8)11-9(12)6-10/h2-5H,6H2,1H3 |
| Molecular Formula | C9H9BrN2 |
| Molecular Weight | 225.0852 |
| Density | 1.52g/cm3 |
| Boiling point | 337°C at 760 mmHg |
| Flash point | 157.6°C |
| Refractive index | 1.642 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
136099-52-0 2-(bromomethyl)-1-methyl-1h-benzimidazole
service@apichina.com