| Product Name | 2-Bromoethyl acrylate |
| CAS No. | 4823-47-6 |
| Synonyms | 2-Bromoethyl acrylate (Acrylic acid 2-bromoethyl ester); Acrylic acid 2-bromoethyl ester; 2-bromoethyl prop-2-enoate |
| InChI | InChI=1/C5H7BrO2/c1-2-5(7)8-4-3-6/h2H,1,3-4H2 |
| Molecular Formula | C5H7BrO2 |
| Molecular Weight | 179.0119 |
| Density | 1.457g/cm3 |
| Boiling point | 188.1°C at 760 mmHg |
| Flash point | 67.6°C |
| Refractive index | 1.472 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
4823-47-6 2-bromoethyl acrylate
service@apichina.com