| Product Name | 2-Bromobenzhydrazide |
| CAS No. | 29418-67-5 |
| Synonyms | 2-Bromobenzohydrazide |
| InChI | InChI=1/C7H7BrN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| Molecular Formula | C7H7BrN2O |
| Molecular Weight | 215.0473 |
| Density | 1.615g/cm3 |
| Boiling point | 367.2°C at 760 mmHg |
| Flash point | 175.9°C |
| Refractive index | 1.615 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
29418-67-5 2-bromobenzhydrazide
service@apichina.com