| Product Name | 2-Bromobenzaldehyde oxime |
| CAS No. | 34158-72-0 |
| Synonyms | 2-Bromobenzaldoxime |
| InChI | InChI=1/C7H6BrNO/c8-7-4-2-1-3-6(7)5-9-10/h1-5,10H/b9-5+ |
| Molecular Formula | C7H6BrNO |
| Molecular Weight | 200.0326 |
| Density | 1.52g/cm3 |
| Melting point | 102-104℃ |
| Boiling point | 265.6°C at 760 mmHg |
| Flash point | 114.4°C |
| Refractive index | 1.581 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
34158-72-0 2-bromobenzaldehyde oxime
service@apichina.com