| Product Name | 2-bromoacrylic acid |
| CAS No. | 10443-65-9 |
| Synonyms | 2-Bromoacrylic acid; CCRIS 5478; NSC 227848; 2-bromoprop-2-enoic acid; 2-bromoprop-2-enoate |
| InChI | InChI=1/C3H3BrO2/c1-2(4)3(5)6/h1H2,(H,5,6)/p-1 |
| Molecular Formula | C3H2BrO2 |
| Molecular Weight | 149.9513 |
| Melting point | 62-65℃ |
| Boiling point | 224.5°C at 760 mmHg |
| Flash point | 89.6°C |
| Risk Codes | R34:Causes burns.; R43:May cause sensitization by skin contact.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
10443-65-9 2-bromoacrylic acid
service@apichina.com