| Product Name | 2-bromo-N-(2-chloroethyl)-N-(3,5-dimethoxybenzyl)ethanamine |
| CAS No. | 4988-66-3 |
| InChI | InChI=1/C13H19BrClNO2/c1-17-12-7-11(8-13(9-12)18-2)10-16(5-3-14)6-4-15/h7-9H,3-6,10H2,1-2H3 |
| Molecular Formula | C13H19BrClNO2 |
| Molecular Weight | 336.6525 |
| Density | 1.338g/cm3 |
| Boiling point | 363.3°C at 760 mmHg |
| Flash point | 173.5°C |
| Refractive index | 1.543 |
4988-66-3 2-bromo-n-(2-chloroethyl)-n-(3,5-dimethoxybenzyl)ethanamine
service@apichina.com