Product Name | 2-Bromo-6-methylbenzoic acid |
CAS No. | 90259-31-7 |
Synonyms | 6-Bromo-o-toluic acid |
InChI | InChI=1/C8H7BrO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,1H3,(H,10,11) |
Molecular Formula | C8H7BrO2 |
Molecular Weight | 215.044 |
Density | 1.6g/cm3 |
Melting point | 108-112℃ |
Boiling point | 307.043°C at 760 mmHg |
Flash point | 139.495°C |
Refractive index | 1.595 |
Hazard Symbols | |
Risk Codes | R22:; |
Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
90259-31-7 2-bromo-6-methylbenzoic acid
service@apichina.com