| Product Name | 2-Bromo-6-methyl-4-nitroaniline |
| CAS No. | 102170-56-9 |
| InChI | InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
| Molecular Formula | C7H7BrN2O2 |
| Molecular Weight | 231.0467 |
| Density | 1.698g/cm3 |
| Melting point | 177-181℃ |
| Boiling point | 366°C at 760 mmHg |
| Flash point | 175.2°C |
| Refractive index | 1.648 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
102170-56-9 2-bromo-6-methyl-4-nitroaniline
service@apichina.com