| Product Name | 2-Bromo-6-fluorotoluene |
| CAS No. | 1422-54-4 |
| Synonyms | Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
| InChI | InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| Molecular Formula | C7H4ClFN2S |
| Molecular Weight | 202.6365 |
| Density | 1.63g/cm3 |
| Boiling point | 294°C at 760 mmHg |
| Flash point | 131.6°C |
| Refractive index | 1.714 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1422-54-4 2-bromo-6-fluorotoluene
service@apichina.com