| Product Name | 2-bromo-6-chloro-4-(trifluoromethyl)aniline |
| CAS No. | 109919-26-8 |
| Synonyms | 2-Bromo-6-chloro-4-trifluoromethylaniline; 4-Amino-3-bromo-5-chlorobenzotrifluoride; 4,5,5-trifluoropent-4-en-1-ol |
| InChI | InChI=1/C5H7F3O/c6-4(5(7)8)2-1-3-9/h9H,1-3H2 |
| Molecular Formula | C5H7F3O |
| Molecular Weight | 140.1037 |
| Density | 1.185g/cm3 |
| Melting point | 27-32℃ |
| Boiling point | 149.5°C at 760 mmHg |
| Flash point | 64.4°C |
| Refractive index | 1.374 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
109919-26-8 2-bromo-6-chloro-4-(trifluoromethyl)aniline
service@apichina.com