| Product Name | 2-Bromo-6-chloro-4-nitroaniline |
| CAS No. | 99-29-6 |
| Synonyms | Benzenamine, 2-bromo-6-chloro-4-nitro-; NSC 88985; Aniline, 2-bromo-6-chloro-4-nitro-; 2-Chloro-4-nitro-6-bromoaniline |
| InChI | InChI=1/C6H4BrClN2O2/c7-4-1-3(10(11)12)2-5(8)6(4)9/h1-2H,9H2 |
| Molecular Formula | C6H4BrClN2O2 |
| Molecular Weight | 251.4652 |
| Density | 1.909g/cm3 |
| Boiling point | 344.7°C at 760 mmHg |
| Flash point | 162.3°C |
| Refractive index | 1.677 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
99-29-6 2-bromo-6-chloro-4-nitroaniline
service@apichina.com