| Product Name | 2-Bromo-5-iodotoluene |
| CAS No. | 202865-85-8 |
| Synonyms | 1-bromo-4-iodo-2-methylbenzene |
| InChI | InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Molecular Formula | C7H6BrI |
| Molecular Weight | 296.931 |
| Density | 2.062g/cm3 |
| Boiling point | 264.2°C at 760 mmHg |
| Flash point | 113.6°C |
| Refractive index | 1.636 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
202865-85-8 2-bromo-5-iodotoluene
service@apichina.com