| Product Name | 2-Bromo-5-fluoronitrobenzene |
| CAS No. | 446-09-3 |
| Synonyms | 1-Bromo-4-fluoro-2-nitrobenzene |
| InChI | InChI=1/C6H3BrFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| Molecular Formula | C6H3BrFNO2 |
| Molecular Weight | 219.9959 |
| Density | 1.808g/cm3 |
| Melting point | 37-39℃ |
| Boiling point | 220.9°C at 760 mmHg |
| Flash point | 87.4°C |
| Refractive index | 1.579 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
446-09-3 2-bromo-5-fluoronitrobenzene
service@apichina.com