| Product Name | 2-Bromo-4-nitropyridine N-oxide |
| CAS No. | 52092-43-0 |
| Synonyms | 2-bromo-4-nitropyridine 1-oxide; 2-bromo-4-nitro-1-oxo-1,2-dihydropyridinium; 2-Bromo-4-nitropyridine-N-oxide |
| InChI | InChI=1/C5H4BrN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3,5H/q+1 |
| Molecular Formula | C5H4BrN2O3 |
| Molecular Weight | 220.0003 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
52092-43-0 2-bromo-4-nitropyridine n-oxide
service@apichina.com