| Product Name | 2-Bromo-4-nitroanisole |
| CAS No. | 5197-28-4 |
| Synonyms | Anisole, 2-bromo-4-nitro-; 2-bromo-1-methoxy-4-nitrobenzene |
| InChI | InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| Molecular Formula | C7H6BrNO3 |
| Molecular Weight | 232.0314 |
| Density | 1.64g/cm3 |
| Melting point | 104-106℃ |
| Boiling point | 306.3°C at 760 mmHg |
| Flash point | 139.1°C |
| Refractive index | 1.581 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5197-28-4 2-bromo-4-nitroanisole
service@apichina.com