| Product Name | 2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid |
| CAS No. | 40003-41-6 |
| Synonyms | 2-bromo-4-methylthiazole-5-carboxylic acid |
| InChI | InChI=1/C5H4BrNO2S/c1-2-3(4(8)9)10-5(6)7-2/h1H3,(H,8,9) |
| Molecular Formula | C5H4BrNO2S |
| Molecular Weight | 222.0598 |
| Density | 1.895g/cm3 |
| Melting point | 153℃ |
| Boiling point | 349.5°C at 760 mmHg |
| Flash point | 165.2°C |
| Refractive index | 1.639 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
40003-41-6 2-bromo-4-methyl-1,3-thiazole-5-carboxylic acid
service@apichina.com