| Product Name | 2-bromo-4-fluoroacetophenone |
| CAS No. | 1006-39-9 |
| Synonyms | 2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| InChI | InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| Molecular Formula | C8H6BrFO |
| Molecular Weight | 217.035 |
| Density | 1.535g/cm3 |
| Boiling point | 258.4°C at 760 mmHg |
| Flash point | 110.1°C |
| Refractive index | 1.534 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1006-39-9 2-bromo-4-fluoroacetophenone
service@apichina.com