| Product Name | 2-Bromo-4-fluoro-1-iodobenzene |
| CAS No. | 202865-73-4 |
| Synonyms | 2-Bromo-4-fluoroiodobenzene |
| InChI | InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| Molecular Formula | C6H3BrFI |
| Molecular Weight | 300.8949 |
| Density | 2.281g/cm3 |
| Boiling point | 243.2°C at 760 mmHg |
| Flash point | 100.9°C |
| Refractive index | 1.628 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
202865-73-4 2-bromo-4-fluoro-1-iodobenzene
service@apichina.com