| Product Name | 2-Bromo-4,6-dimethylaniline |
| CAS No. | 41825-73-4 |
| Synonyms | Benzenamine, 2-bromo-4,6-dimethyl-; 2-Bromo-4,6-dimethylbenzenamine |
| InChI | InChI=1/C8H10BrN/c1-5-3-6(2)8(10)7(9)4-5/h3-4H,10H2,1-2H3 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.0757 |
| Density | 1.424g/cm3 |
| Melting point | 49-79℃ |
| Boiling point | 260.9°C at 760 mmHg |
| Flash point | 111.6°C |
| Refractive index | 1.596 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
41825-73-4 2-bromo-4,6-dimethylaniline
service@apichina.com