| Product Name | 2-Bromo-4,6-dichloroaniline |
| CAS No. | 697-86-9 |
| Synonyms | 2-bromo-1-(4-cyclohexylphenyl)ethanone; Benzenamine, 2-bromo-4,6-dichloro- |
| InChI | InChI=1/C6H4BrCl2N/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,10H2 |
| Molecular Formula | C6H4BrCl2N |
| Molecular Weight | 240.9127 |
| Density | 1.827g/cm3 |
| Boiling point | 273°C at 760 mmHg |
| Flash point | 121.8°C |
| Refractive index | 1.648 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
697-86-9 2-bromo-4,6-dichloroaniline
service@apichina.com