| Product Name | 2-Bromo-3-methyl-5-nitropyridine |
| CAS No. | 23132-21-0 |
| Synonyms | 2-Bromo-5-nitro-3-picoline |
| InChI | InChI=1/C6H5BrN2O2/c1-4-2-5(9(10)11)3-8-6(4)7/h2-3H,1H3 |
| Molecular Formula | C6H5BrN2O2 |
| Molecular Weight | 217.0201 |
| Density | 1.709g/cm3 |
| Boiling point | 305.1°C at 760 mmHg |
| Flash point | 138.3°C |
| Refractive index | 1.599 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
23132-21-0 2-bromo-3-methyl-5-nitropyridine
service@apichina.com