| Product Name | 2-Bromo-3-chloropyridine |
| CAS No. | 96424-68-9 |
| InChI | InChI=1/C5H3BrClN/c6-5-4(7)2-1-3-8-5/h1-3H |
| Molecular Formula | C5H3BrClN |
| Molecular Weight | 192.441 |
| Density | 1.736g/cm3 |
| Boiling point | 223.9°C at 760 mmHg |
| Flash point | 89.2°C |
| Refractive index | 1.581 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
96424-68-9 2-bromo-3-chloropyridine
service@apichina.com