| Product Name | 2-Bromo-3,4,5,6-tetrafluorobenzoylchloride |
| CAS No. | 151096-42-3 |
| Synonyms | 2-Bromo-3,4,5,6-tetrafluorobenzoyl chloride |
| InChI | InChI=1/C7BrClF4O/c8-2-1(7(9)14)3(10)5(12)6(13)4(2)11 |
| Molecular Formula | C7BrClF4O |
| Molecular Weight | 291.4249 |
| Density | 1.957g/cm3 |
| Boiling point | 216.6°C at 760 mmHg |
| Flash point | 84.8°C |
| Refractive index | 1.505 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
151096-42-3 2-bromo-3,4,5,6-tetrafluorobenzoylchloride
service@apichina.com