| Product Name | 2-bromo-2-phenylindane-1,3-dione |
| CAS No. | 1801-20-3 |
| Synonyms | 1,3-Indandione, 2-bromo-2-phenyl-; 2-Bromo-2-phenyl-1H-indene-1,3(2H)-dione; BRN 1971277; NSC 267317 |
| InChI | InChI=1/C15H9BrO2/c16-15(10-6-2-1-3-7-10)13(17)11-8-4-5-9-12(11)14(15)18/h1-9H |
| Molecular Formula | C15H9BrO2 |
| Molecular Weight | 301.1348 |
| Density | 1.597g/cm3 |
| Melting point | 106℃ |
| Boiling point | 420.3°C at 760 mmHg |
| Flash point | 134°C |
| Refractive index | 1.675 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1801-20-3 2-bromo-2-phenylindane-1,3-dione
service@apichina.com