| Product Name | 2-bromo-2-cyanohexafluoropropane |
| CAS No. | 52198-56-8 |
| Synonyms | 2-Bromo-2-cyanohexafluoropropane~2-Bromo-2-(trifluoromethyl)-3,3,3-trifluoropropionitrile; 2-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propanenitrile; (2E)-3-(dimethylamino)-2-[(4-fluorophenyl)carbonyl]prop-2-enenitrile |
| InChI | InChI=1/C12H11FN2O/c1-15(2)8-10(7-14)12(16)9-3-5-11(13)6-4-9/h3-6,8H,1-2H3/b10-8+ |
| Molecular Formula | C12H11FN2O |
| Molecular Weight | 218.2269 |
| Density | 1.178g/cm3 |
| Boiling point | 408.1°C at 760 mmHg |
| Flash point | 200.6°C |
| Refractive index | 1.542 |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
52198-56-8 2-bromo-2-cyanohexafluoropropane
service@apichina.com