| Product Name | 2-bromo-1-benzofuran |
| CAS No. | 54008-77-4 |
| Synonyms | 2-bromobenzofuran |
| InChI | InChI=1/C8H5BrO/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H |
| Molecular Formula | C8H5BrO |
| Molecular Weight | 197.0287 |
| Density | 1.608g/cm3 |
| Boiling point | 233.807°C at 760 mmHg |
| Flash point | 95.203°C |
| Refractive index | 1.639 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
54008-77-4 2-bromo-1-benzofuran
service@apichina.com